C31H28F4N6O4S — CID 155578548
3-(4-phenoxyphenyl)-1-[(3R)-1-(2,3,4,5-tetrafluoro-6-propan-2-yloxyphenyl)sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 155578548) has the molecular formula C31H28F4N6O4S and a molecular weight of 656.66 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-[(3R)-1-(2,3,4,5-tetrafluoro-6-propan-2-yloxyphenyl)sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-(2,3,4,5-tetrafluoro-6-propan-2-yloxyphenyl)sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155578548 |
| Molecular Formula | C31H28F4N6O4S |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-(2,3,4,5-tetrafluoro-6-propan-2-yloxyphenyl)sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)Oc1c(F)c(F)c(F)c(F)c1S(=O)(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C31H28F4N6O4S/c1-17(2)44-28-25(34)23(32)24(33)26(35)29(28)46(42,43)40-14-6-7-19(15-40)41-31-22(30(36)37-16-38-31)27(39-41)18-10-12-21(13-11-18)45-20-8-4-3-5-9-20/h3-5,8-13,16-17,19H,6-7,14-15H2,1-2H3,(H2,36,37,38)/t19-/m1/s1 |
| InChIKey | YYOSYEBYCJQKGT-LJQANCHMSA-N |
| XLogP | 6.24 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|