C29H21F7N6O3S — CID 155578563
3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 155578563) has the molecular formula C29H21F7N6O3S and a molecular weight of 666.58 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155578563 |
| Molecular Formula | C29H21F7N6O3S |
| Molecular Weight | 666.58 g/mol |
| Exact Mass | 666.13 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2[C@@H]1CCCN(S(=O)(=O)c2c(F)c(F)c(F)c(F)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C29H21F7N6O3S/c30-21-20(29(34,35)36)26(24(33)23(32)22(21)31)46(43,44)41-12-4-5-16(13-41)42-28-19(27(37)38-14-39-28)25(40-42)15-8-10-18(11-9-15)45-17-6-2-1-3-7-17/h1-3,6-11,14,16H,4-5,12-13H2,(H2,37,38,39)/t16-/m1/s1 |
| InChIKey | MNCYOOXSIAVVPU-MRXNPFEDSA-N |
| XLogP | 6.47 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|