C48H46N2O2 — CID 155579516
2-[[1-[[2-hydroxy-5-methyl-3-(9-methylfluoren-9-yl)phenyl]methyl]-3-methylimidazolidin-1-ium-2-id-1-yl]methyl]-4-methyl-6-(9-methylfluoren-9-yl)phenol (PubChem CID 155579516) has the molecular formula C48H46N2O2 and a molecular weight of 682.91 g/mol. Its IUPAC name is 2-[[1-[[2-hydroxy-5-methyl-3-(9-methylfluoren-9-yl)phenyl]methyl]-3-methylimidazolidin-1-ium-2-id-1-yl]methyl]-4-methyl-6-(9-methylfluoren-9-yl)phenol.
| Compound Name | 2-[[1-[[2-hydroxy-5-methyl-3-(9-methylfluoren-9-yl)phenyl]methyl]-3-methylimidazolidin-1-ium-2-id-1-yl]methyl]-4-methyl-6-(9-methylfluoren-9-yl)phenol |
|---|---|
| PubChem CID | 155579516 |
| Molecular Formula | C48H46N2O2 |
| Molecular Weight | 682.91 g/mol |
| Exact Mass | 682.36 |
| IUPAC Name | 2-[[1-[[2-hydroxy-5-methyl-3-(9-methylfluoren-9-yl)phenyl]methyl]-3-methylimidazolidin-1-ium-2-id-1-yl]methyl]-4-methyl-6-(9-methylfluoren-9-yl)phenol |
| SMILES | Cc1cc(C[N+]2(Cc3cc(C)cc(C4(C)c5ccccc5-c5ccccc54)c3O)[CH-]N(C)CC2)c(O)c(C2(C)c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C48H46N2O2/c1-31-24-33(45(51)43(26-31)47(3)39-18-10-6-14-35(39)36-15-7-11-19-40(36)47)28-50(23-22-49(5)30-50)29-34-25-32(2)27-44(46(34)52)48(4)41-20-12-8-16-37(41)38-17-9-13-21-42(38)48/h6-21,24-27,30,51-52H,22-23,28-29H2,1-5H3 |
| InChIKey | AIBZRJBTDAONQP-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.91 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|