About 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine
3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine (PubChem CID 155582078) has the molecular formula C15H17F2N5O3
and a molecular weight of 353.33 g/mol. Its IUPAC name is 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine.
Molecular Properties
| Compound Name | 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine |
| PubChem CID | 155582078 |
| Molecular Formula | C15H17F2N5O3 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine |
| SMILES | C=C(O)C(N)(F)F.O=[N+]([O-])c1ccc2c(N3CCCC3)nncc2c1 |
| InChI | InChI=1S/C12H12N4O2.C3H5F2NO/c17-16(18)10-3-4-11-9(7-10)8-13-14-12(11)15-5-1-2-6-15;1-2(7)3(4,5)6/h3-4,7-8H,1-2,5-6H2;7H,1,6H2 |
| InChIKey | LDMWTDWOGDLPPE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine?
The IUPAC name of 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine (CID 155582078) is 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine.
What is the SMILES notation for 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine?
The canonical SMILES for 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine is C=C(O)C(N)(F)F.O=[N+]([O-])c1ccc2c(N3CCCC3)nncc2c1.
What is the InChIKey of 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine?
The InChIKey is LDMWTDWOGDLPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2.C3H5F2NO/c17-16(18)10-3-4-11-9(7-10)8-13-14-12(11)15-5-1-2-6-15;1-2(7)3(4,5)6/h3-4,7-8H,1-2,5-6H2;7H,1,6H2.
What are the key properties of 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine?
3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine has a molecular weight of 353.33 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3,3-difluoroprop-1-en-2-ol;6-nitro-1-pyrrolidin-1-ylphthalazine is sourced from PubChem (CID 155582078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).