C15H12F3N7O2 — CID 155585231
N',3-dihydroxy-5-[[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]pyridine-2-carboximidamide (PubChem CID 155585231) has the molecular formula C15H12F3N7O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is N',3-dihydroxy-5-[[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]pyridine-2-carboximidamide.
| Compound Name | N',3-dihydroxy-5-[[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 155585231 |
| Molecular Formula | C15H12F3N7O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N',3-dihydroxy-5-[[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]pyridine-2-carboximidamide |
| SMILES | NC(=NO)c1ncc(Nc2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1O |
| InChI | InChI=1S/C15H12F3N7O2/c16-15(17,18)8-1-3-10(4-2-8)25-7-21-14(23-25)22-9-5-11(26)12(20-6-9)13(19)24-27/h1-7,26-27H,(H2,19,24)(H,22,23) |
| InChIKey | UJKPUZZIUMRLNJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|