C26H22FN7O3 — CID 155586401
1-[C-[(Z)-2-amino-2-cyclopropylethenyl]-N-phenylcarbonimidoyl]-3-[2-fluoro-4-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]phenyl]urea (PubChem CID 155586401) has the molecular formula C26H22FN7O3 and a molecular weight of 499.51 g/mol. Its IUPAC name is 1-[C-[(Z)-2-amino-2-cyclopropylethenyl]-N-phenylcarbonimidoyl]-3-[2-fluoro-4-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]phenyl]urea.
| Compound Name | 1-[C-[(Z)-2-amino-2-cyclopropylethenyl]-N-phenylcarbonimidoyl]-3-[2-fluoro-4-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]phenyl]urea |
|---|---|
| PubChem CID | 155586401 |
| Molecular Formula | C26H22FN7O3 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1-[C-[(Z)-2-amino-2-cyclopropylethenyl]-N-phenylcarbonimidoyl]-3-[2-fluoro-4-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]phenyl]urea |
| SMILES | N/C(=C\C(=N/c1ccccc1)NC(=O)Nc1ccc(Oc2ccnc3[nH]c(=O)cnc23)cc1F)C1CC1 |
| InChI | InChI=1S/C26H22FN7O3/c27-18-12-17(37-21-10-11-29-25-24(21)30-14-23(35)34-25)8-9-20(18)32-26(36)33-22(13-19(28)15-6-7-15)31-16-4-2-1-3-5-16/h1-5,8-15H,6-7,28H2,(H,29,34,35)(H2,31,32,33,36)/b19-13- |
| InChIKey | BPJIGRGGKKMSKU-UYRXBGFRSA-N |
| XLogP | 4.35 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|