C18H22N4O3 — CID 91379636
ethane;N-methylacetamide;8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 91379636) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethane;N-methylacetamide;8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one.
| Compound Name | ethane;N-methylacetamide;8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 91379636 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethane;N-methylacetamide;8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | CC.CNC(C)=O.O=c1cnc2c(Oc3ccccc3)ccnc2[nH]1 |
| InChI | InChI=1S/C13H9N3O2.C3H7NO.C2H6/c17-11-8-15-12-10(6-7-14-13(12)16-11)18-9-4-2-1-3-5-9;1-3(5)4-2;1-2/h1-8H,(H,14,16,17);1-2H3,(H,4,5);1-2H3 |
| InChIKey | DQQAVYXJNGHVAO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |