C26H26N8O3 — CID 155586595
1-[C-[(Z)-2-amino-3,3-dimethylbut-1-enyl]-N-phenylcarbonimidoyl]-3-[6-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]-3-pyridinyl]urea (PubChem CID 155586595) has the molecular formula C26H26N8O3 and a molecular weight of 498.55 g/mol. Its IUPAC name is 1-[C-[(Z)-2-amino-3,3-dimethylbut-1-enyl]-N-phenylcarbonimidoyl]-3-[6-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]-3-pyridinyl]urea.
| Compound Name | 1-[C-[(Z)-2-amino-3,3-dimethylbut-1-enyl]-N-phenylcarbonimidoyl]-3-[6-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 155586595 |
| Molecular Formula | C26H26N8O3 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 1-[C-[(Z)-2-amino-3,3-dimethylbut-1-enyl]-N-phenylcarbonimidoyl]-3-[6-[(3-oxo-4H-pyrido[2,3-b]pyrazin-8-yl)oxy]-3-pyridinyl]urea |
| SMILES | CC(C)(C)/C(N)=C/C(=N\c1ccccc1)NC(=O)Nc1ccc(Oc2ccnc3[nH]c(=O)cnc23)nc1 |
| InChI | InChI=1S/C26H26N8O3/c1-26(2,3)19(27)13-20(31-16-7-5-4-6-8-16)33-25(36)32-17-9-10-22(29-14-17)37-18-11-12-28-24-23(18)30-15-21(35)34-24/h4-15H,27H2,1-3H3,(H,28,34,35)(H2,31,32,33,36)/b19-13- |
| InChIKey | MHZHOEXMNWYAAJ-UYRXBGFRSA-N |
| XLogP | 4.25 |
| TPSA | 160.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|