C21H17N4O5P — CID 162112923
ethyl 2-oxoacetate;8-(4-iminophosphanylnaphthalen-1-yl)oxy-4H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 162112923) has the molecular formula C21H17N4O5P and a molecular weight of 436.36 g/mol. Its IUPAC name is ethyl 2-oxoacetate;8-(4-iminophosphanylnaphthalen-1-yl)oxy-4H-pyrido[2,3-b]pyrazin-3-one.
| Compound Name | ethyl 2-oxoacetate;8-(4-iminophosphanylnaphthalen-1-yl)oxy-4H-pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 162112923 |
| Molecular Formula | C21H17N4O5P |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | ethyl 2-oxoacetate;8-(4-iminophosphanylnaphthalen-1-yl)oxy-4H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | CCOC(=O)C=O.[H]/N=P/c1ccc(Oc2ccnc3[nH]c(=O)cnc23)c2ccccc12 |
| InChI | InChI=1S/C17H11N4O2P.C4H6O3/c18-24-14-6-5-12(10-3-1-2-4-11(10)14)23-13-7-8-19-17-16(13)20-9-15(22)21-17;1-2-7-4(6)3-5/h1-9,18H,(H,19,21,22);3H,2H2,1H3 |
| InChIKey | ZGJUCWJVXPNZAV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|