C10H18N2O3 — CID 155587386
1-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]cyclopropane-1-carbaldehyde;methanol (PubChem CID 155587386) has the molecular formula C10H18N2O3 and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]cyclopropane-1-carbaldehyde;methanol.
| Compound Name | 1-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]cyclopropane-1-carbaldehyde;methanol |
|---|---|
| PubChem CID | 155587386 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]cyclopropane-1-carbaldehyde;methanol |
| SMILES | CO.CO/C(N)=C/C=C(\N)C1(C=O)CC1 |
| InChI | InChI=1S/C9H14N2O2.CH4O/c1-13-8(11)3-2-7(10)9(6-12)4-5-9;1-2/h2-3,6H,4-5,10-11H2,1H3;2H,1H3/b7-2-,8-3+; |
| InChIKey | JMJFBOVUJYZWCH-FOIQYCMVSA-N |
| XLogP | -0.14 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|