C12H22O4 — CID 144892005
bicyclo[2.2.1]heptane-1,4-dicarbaldehyde;methanol;methoxymethane (PubChem CID 144892005) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane-1,4-dicarbaldehyde;methanol;methoxymethane.
| Compound Name | bicyclo[2.2.1]heptane-1,4-dicarbaldehyde;methanol;methoxymethane |
|---|---|
| PubChem CID | 144892005 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | bicyclo[2.2.1]heptane-1,4-dicarbaldehyde;methanol;methoxymethane |
| SMILES | CO.COC.O=CC12CCC(C=O)(CC1)C2 |
| InChI | InChI=1S/C9H12O2.C2H6O.CH4O/c10-6-8-1-2-9(5-8,7-11)4-3-8;1-3-2;1-2/h6-7H,1-5H2;1-2H3;2H,1H3 |
| InChIKey | TWVWKEAJAUEKJQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|