C11H19N3O3 — CID 156724075
2-[1-[(1E,3E)-1,4-diamino-4-methoxybuta-1,3-dien-2-yl]cyclobutyl]oxyacetamide (PubChem CID 156724075) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[1-[(1E,3E)-1,4-diamino-4-methoxybuta-1,3-dien-2-yl]cyclobutyl]oxyacetamide.
| Compound Name | 2-[1-[(1E,3E)-1,4-diamino-4-methoxybuta-1,3-dien-2-yl]cyclobutyl]oxyacetamide |
|---|---|
| PubChem CID | 156724075 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-[1-[(1E,3E)-1,4-diamino-4-methoxybuta-1,3-dien-2-yl]cyclobutyl]oxyacetamide |
| SMILES | CO/C(N)=C/C(=C\N)C1(OCC(N)=O)CCC1 |
| InChI | InChI=1S/C11H19N3O3/c1-16-10(14)5-8(6-12)11(3-2-4-11)17-7-9(13)15/h5-6H,2-4,7,12,14H2,1H3,(H2,13,15)/b8-6+,10-5+ |
| InChIKey | RKDHSDDKNCHHTO-SOYUKNQTSA-N |
| XLogP | -0.30 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|