C24H25N3O2 — CID 155588762
4-[[2-(4-ethenyl-3-methylphenyl)acetyl]amino]-N-(1-ethynylcyclopentyl)pyridine-2-carboxamide (PubChem CID 155588762) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[[2-(4-ethenyl-3-methylphenyl)acetyl]amino]-N-(1-ethynylcyclopentyl)pyridine-2-carboxamide.
| Compound Name | 4-[[2-(4-ethenyl-3-methylphenyl)acetyl]amino]-N-(1-ethynylcyclopentyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155588762 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-[[2-(4-ethenyl-3-methylphenyl)acetyl]amino]-N-(1-ethynylcyclopentyl)pyridine-2-carboxamide |
| SMILES | C#CC1(NC(=O)c2cc(NC(=O)Cc3ccc(C=C)c(C)c3)ccn2)CCCC1 |
| InChI | InChI=1S/C24H25N3O2/c1-4-19-9-8-18(14-17(19)3)15-22(28)26-20-10-13-25-21(16-20)23(29)27-24(5-2)11-6-7-12-24/h2,4,8-10,13-14,16H,1,6-7,11-12,15H2,3H3,(H,27,29)(H,25,26,28) |
| InChIKey | HZWUUBUSLFKPFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|