C26H24N4O2 — CID 155589102
N-(2,3-diphenyl-1,7-naphthyridin-6-yl)-3-methoxypyrrolidine-1-carboxamide (PubChem CID 155589102) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-(2,3-diphenyl-1,7-naphthyridin-6-yl)-3-methoxypyrrolidine-1-carboxamide.
| Compound Name | N-(2,3-diphenyl-1,7-naphthyridin-6-yl)-3-methoxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 155589102 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-(2,3-diphenyl-1,7-naphthyridin-6-yl)-3-methoxypyrrolidine-1-carboxamide |
| SMILES | COC1CCN(C(=O)Nc2cc3cc(-c4ccccc4)c(-c4ccccc4)nc3cn2)C1 |
| InChI | InChI=1S/C26H24N4O2/c1-32-21-12-13-30(17-21)26(31)29-24-15-20-14-22(18-8-4-2-5-9-18)25(28-23(20)16-27-24)19-10-6-3-7-11-19/h2-11,14-16,21H,12-13,17H2,1H3,(H,27,29,31) |
| InChIKey | MZTKTLSUFMXGCD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |