C18H25N — CID 155589594
(1Z,7E)-4-ethyl-6,6,11,11-tetramethyl-9-azabicyclo[6.5.0]trideca-1,3,7,9,12-pentaene (PubChem CID 155589594) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is (1Z,7E)-4-ethyl-6,6,11,11-tetramethyl-9-azabicyclo[6.5.0]trideca-1,3,7,9,12-pentaene.
| Compound Name | (1Z,7E)-4-ethyl-6,6,11,11-tetramethyl-9-azabicyclo[6.5.0]trideca-1,3,7,9,12-pentaene |
|---|---|
| PubChem CID | 155589594 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (1Z,7E)-4-ethyl-6,6,11,11-tetramethyl-9-azabicyclo[6.5.0]trideca-1,3,7,9,12-pentaene |
| SMILES | CCC1=C/C=C2/C=CC(C)(C)C=N/C2=C/C(C)(C)C1 |
| InChI | InChI=1S/C18H25N/c1-6-14-7-8-15-9-10-17(2,3)13-19-16(15)12-18(4,5)11-14/h7-10,12-13H,6,11H2,1-5H3/b14-7?,15-8-,16-12+ |
| InChIKey | IFLROVSUPKTJEV-YCYMCDSGSA-N |
| XLogP | 5.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |