C24H29N7O2S — CID 155589825
N-[2-[[6-[(5-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-[methyl(prop-2-enoyl)amino]propanamide (PubChem CID 155589825) has the molecular formula C24H29N7O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is N-[2-[[6-[(5-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-[methyl(prop-2-enoyl)amino]propanamide.
| Compound Name | N-[2-[[6-[(5-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-[methyl(prop-2-enoyl)amino]propanamide |
|---|---|
| PubChem CID | 155589825 |
| Molecular Formula | C24H29N7O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[2-[[6-[(5-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-[methyl(prop-2-enoyl)amino]propanamide |
| SMILES | C=CC(=O)N(C)C(C)C(=O)NCCNc1cc(Nc2ncc(C3=CC=CCC=C3)s2)nc(C)n1 |
| InChI | InChI=1S/C24H29N7O2S/c1-5-22(32)31(4)16(2)23(33)26-13-12-25-20-14-21(29-17(3)28-20)30-24-27-15-19(34-24)18-10-8-6-7-9-11-18/h5-6,8-11,14-16H,1,7,12-13H2,2-4H3,(H,26,33)(H2,25,27,28,29,30) |
| InChIKey | ONRDGPLRHNIMME-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|