C10H8F2N2O4S — CID 155590882
2-[(3-cyano-4,5-difluorophenyl)sulfonyl-methylamino]acetic acid (PubChem CID 155590882) has the molecular formula C10H8F2N2O4S and a molecular weight of 290.25 g/mol. Its IUPAC name is 2-[(3-cyano-4,5-difluorophenyl)sulfonyl-methylamino]acetic acid.
| Compound Name | 2-[(3-cyano-4,5-difluorophenyl)sulfonyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 155590882 |
| Molecular Formula | C10H8F2N2O4S |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-[(3-cyano-4,5-difluorophenyl)sulfonyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)S(=O)(=O)c1cc(F)c(F)c(C#N)c1 |
| InChI | InChI=1S/C10H8F2N2O4S/c1-14(5-9(15)16)19(17,18)7-2-6(4-13)10(12)8(11)3-7/h2-3H,5H2,1H3,(H,15,16) |
| InChIKey | XIPVLCUTOWMFGK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |