C24H30BrNO4 — CID 155591901
tert-butyl 9-(4-bromo-2,6-dimethylphenyl)-8,10-dioxo-2-azadispiro[3.1.56.14]dodecane-2-carboxylate (PubChem CID 155591901) has the molecular formula C24H30BrNO4 and a molecular weight of 476.41 g/mol. Its IUPAC name is tert-butyl 9-(4-bromo-2,6-dimethylphenyl)-8,10-dioxo-2-azadispiro[3.1.56.14]dodecane-2-carboxylate.
| Compound Name | tert-butyl 9-(4-bromo-2,6-dimethylphenyl)-8,10-dioxo-2-azadispiro[3.1.56.14]dodecane-2-carboxylate |
|---|---|
| PubChem CID | 155591901 |
| Molecular Formula | C24H30BrNO4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | tert-butyl 9-(4-bromo-2,6-dimethylphenyl)-8,10-dioxo-2-azadispiro[3.1.56.14]dodecane-2-carboxylate |
| SMILES | Cc1cc(Br)cc(C)c1C1C(=O)CC2(CC1=O)CC1(CN(C(=O)OC(C)(C)C)C1)C2 |
| InChI | InChI=1S/C24H30BrNO4/c1-14-6-16(25)7-15(2)19(14)20-17(27)8-23(9-18(20)28)10-24(11-23)12-26(13-24)21(29)30-22(3,4)5/h6-7,20H,8-13H2,1-5H3 |
| InChIKey | NPOFGOYCSBFEAJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|