C15H17IN8O — CID 155594661
5-[[6-iodo-5-[(4-methylmorpholin-2-yl)methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile (PubChem CID 155594661) has the molecular formula C15H17IN8O and a molecular weight of 452.26 g/mol. Its IUPAC name is 5-[[6-iodo-5-[(4-methylmorpholin-2-yl)methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[6-iodo-5-[(4-methylmorpholin-2-yl)methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 155594661 |
| Molecular Formula | C15H17IN8O |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 5-[[6-iodo-5-[(4-methylmorpholin-2-yl)methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
| SMILES | CN1CCOC(CNc2cc(Nc3cnc(C#N)cn3)nnc2I)C1 |
| InChI | InChI=1S/C15H17IN8O/c1-24-2-3-25-11(9-24)7-19-12-4-13(22-23-15(12)16)21-14-8-18-10(5-17)6-20-14/h4,6,8,11H,2-3,7,9H2,1H3,(H2,19,20,21,22) |
| InChIKey | BUNGISCNCREHBB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|