C16H26N2O2 — CID 15559614
5-butanoyl-1,2,3,4,4a,5,8,9,10,11,11a,11b-dodecahydropyrido[2,1-f][1,6]naphthyridin-6-one (PubChem CID 15559614) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 5-butanoyl-1,2,3,4,4a,5,8,9,10,11,11a,11b-dodecahydropyrido[2,1-f][1,6]naphthyridin-6-one.
| Compound Name | 5-butanoyl-1,2,3,4,4a,5,8,9,10,11,11a,11b-dodecahydropyrido[2,1-f][1,6]naphthyridin-6-one |
|---|---|
| PubChem CID | 15559614 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 5-butanoyl-1,2,3,4,4a,5,8,9,10,11,11a,11b-dodecahydropyrido[2,1-f][1,6]naphthyridin-6-one |
| SMILES | CCCC(=O)C1C(=O)N2CCCCC2C2CCCNC12 |
| InChI | InChI=1S/C16H26N2O2/c1-2-6-13(19)14-15-11(7-5-9-17-15)12-8-3-4-10-18(12)16(14)20/h11-12,14-15,17H,2-10H2,1H3 |
| InChIKey | RZWGLLGWRRVAKM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|