C26H20ClN3O — CID 155598933
(5-chloro-2-naphthalen-1-ylbenzimidazol-1-yl)-[4-(dimethylamino)phenyl]methanone (PubChem CID 155598933) has the molecular formula C26H20ClN3O and a molecular weight of 425.92 g/mol. Its IUPAC name is (5-chloro-2-naphthalen-1-ylbenzimidazol-1-yl)-[4-(dimethylamino)phenyl]methanone.
| Compound Name | (5-chloro-2-naphthalen-1-ylbenzimidazol-1-yl)-[4-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 155598933 |
| Molecular Formula | C26H20ClN3O |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | (5-chloro-2-naphthalen-1-ylbenzimidazol-1-yl)-[4-(dimethylamino)phenyl]methanone |
| SMILES | CN(C)c1ccc(C(=O)n2c(-c3cccc4ccccc34)nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C26H20ClN3O/c1-29(2)20-13-10-18(11-14-20)26(31)30-24-15-12-19(27)16-23(24)28-25(30)22-9-5-7-17-6-3-4-8-21(17)22/h3-16H,1-2H3 |
| InChIKey | MJZGVHIQAVJWEF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |