C31H32N2O — CID 155599018
ethane;(6-ethenyl-2-naphthalen-1-ylbenzimidazol-1-yl)-(4-methylphenyl)methanone (PubChem CID 155599018) has the molecular formula C31H32N2O and a molecular weight of 448.61 g/mol. Its IUPAC name is ethane;(6-ethenyl-2-naphthalen-1-ylbenzimidazol-1-yl)-(4-methylphenyl)methanone.
| Compound Name | ethane;(6-ethenyl-2-naphthalen-1-ylbenzimidazol-1-yl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 155599018 |
| Molecular Formula | C31H32N2O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | ethane;(6-ethenyl-2-naphthalen-1-ylbenzimidazol-1-yl)-(4-methylphenyl)methanone |
| SMILES | C=Cc1ccc2nc(-c3cccc4ccccc34)n(C(=O)c3ccc(C)cc3)c2c1.CC.CC |
| InChI | InChI=1S/C27H20N2O.2C2H6/c1-3-19-13-16-24-25(17-19)29(27(30)21-14-11-18(2)12-15-21)26(28-24)23-10-6-8-20-7-4-5-9-22(20)23;2*1-2/h3-17H,1H2,2H3;2*1-2H3 |
| InChIKey | DNUVFMPHKAVNCV-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |