C28H14ClF2N2O+ — CID 164941891
[2-(4H-anthracen-4-ylium-9-yl)-5-chlorobenzimidazol-1-yl]-(3,4-difluorophenyl)methanone (PubChem CID 164941891) has the molecular formula C28H14ClF2N2O+ and a molecular weight of 467.88 g/mol. Its IUPAC name is [2-(4H-anthracen-4-ylium-9-yl)-5-chlorobenzimidazol-1-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [2-(4H-anthracen-4-ylium-9-yl)-5-chlorobenzimidazol-1-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 164941891 |
| Molecular Formula | C28H14ClF2N2O+ |
| Molecular Weight | 467.88 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | [2-(4H-anthracen-4-ylium-9-yl)-5-chlorobenzimidazol-1-yl]-(3,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)n1c(-c2c3c(cc4ccccc24)[C+]=CC=C3)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C28H14ClF2N2O/c29-19-10-12-25-24(15-19)32-27(33(25)28(34)18-9-11-22(30)23(31)14-18)26-20-7-3-1-5-16(20)13-17-6-2-4-8-21(17)26/h1-5,7-15H/q+1 |
| InChIKey | UVDRDJFZRQOVAD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.88 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|