C42H36BNO2 — CID 155599999
1,3-diphenyl-9-(3-phenylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 155599999) has the molecular formula C42H36BNO2 and a molecular weight of 597.57 g/mol. Its IUPAC name is 1,3-diphenyl-9-(3-phenylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 1,3-diphenyl-9-(3-phenylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 155599999 |
| Molecular Formula | C42H36BNO2 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | 1,3-diphenyl-9-(3-phenylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CC1(C)OB(c2cccc3c4cc(-c5ccccc5)cc(-c5ccccc5)c4n(-c4cccc(-c5ccccc5)c4)c23)OC1(C)C |
| InChI | InChI=1S/C42H36BNO2/c1-41(2)42(3,4)46-43(45-41)38-25-15-24-35-37-28-33(30-18-10-6-11-19-30)27-36(31-20-12-7-13-21-31)39(37)44(40(35)38)34-23-14-22-32(26-34)29-16-8-5-9-17-29/h5-28H,1-4H3 |
| InChIKey | AMWRMLLMUVELBC-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|