C35H31BN2O2 — CID 167328750
1,2,5-triphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,1-a]isoquinoline (PubChem CID 167328750) has the molecular formula C35H31BN2O2 and a molecular weight of 522.46 g/mol. Its IUPAC name is 1,2,5-triphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,1-a]isoquinoline.
| Compound Name | 1,2,5-triphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 167328750 |
| Molecular Formula | C35H31BN2O2 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 1,2,5-triphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,1-a]isoquinoline |
| SMILES | CC1(C)OB(c2cccc3c2cc(-c2ccccc2)n2nc(-c4ccccc4)c(-c4ccccc4)c32)OC1(C)C |
| InChI | InChI=1S/C35H31BN2O2/c1-34(2)35(3,4)40-36(39-34)29-22-14-21-27-28(29)23-30(24-15-8-5-9-16-24)38-33(27)31(25-17-10-6-11-18-25)32(37-38)26-19-12-7-13-20-26/h5-23H,1-4H3 |
| InChIKey | MBJROFAJMUWREW-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|