C30H29BN2O2 — CID 140939982
1-methyl-5-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[5,1-a]isoquinoline (PubChem CID 140939982) has the molecular formula C30H29BN2O2 and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-methyl-5-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[5,1-a]isoquinoline.
| Compound Name | 1-methyl-5-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 140939982 |
| Molecular Formula | C30H29BN2O2 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-methyl-5-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[5,1-a]isoquinoline |
| SMILES | Cc1c(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2)nn2c(-c3ccccc3)cc3ccccc3c12 |
| InChI | InChI=1S/C30H29BN2O2/c1-20-27(23-15-11-16-24(18-23)31-34-29(2,3)30(4,5)35-31)32-33-26(21-12-7-6-8-13-21)19-22-14-9-10-17-25(22)28(20)33/h6-19H,1-5H3 |
| InChIKey | NISLLBCFNQXBOX-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|