C42H58N4O3Si — CID 155600597
tert-butyl 4-[4-(2-phenylpyrrolidin-1-yl)piperidin-1-yl]-2-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-5-yl]oxybenzoate (PubChem CID 155600597) has the molecular formula C42H58N4O3Si and a molecular weight of 695.04 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-phenylpyrrolidin-1-yl)piperidin-1-yl]-2-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-5-yl]oxybenzoate.
| Compound Name | tert-butyl 4-[4-(2-phenylpyrrolidin-1-yl)piperidin-1-yl]-2-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-5-yl]oxybenzoate |
|---|---|
| PubChem CID | 155600597 |
| Molecular Formula | C42H58N4O3Si |
| Molecular Weight | 695.04 g/mol |
| Exact Mass | 694.43 |
| IUPAC Name | tert-butyl 4-[4-(2-phenylpyrrolidin-1-yl)piperidin-1-yl]-2-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-5-yl]oxybenzoate |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2cc(Oc3cc(N4CCC(N5CCCC5c5ccccc5)CC4)ccc3C(=O)OC(C)(C)C)cnc21 |
| InChI | InChI=1S/C42H58N4O3Si/c1-29(2)50(30(3)4,31(5)6)46-25-19-33-26-36(28-43-40(33)46)48-39-27-35(17-18-37(39)41(47)49-42(7,8)9)44-23-20-34(21-24-44)45-22-13-16-38(45)32-14-11-10-12-15-32/h10-12,14-15,17-19,25-31,34,38H,13,16,20-24H2,1-9H3 |
| InChIKey | PQCUQJGUENGYTA-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.04 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|