C40H55N5O6SSi — CID 171769072
tert-butyl 4-[4-[1-(methanesulfonamido)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate (PubChem CID 171769072) has the molecular formula C40H55N5O6SSi and a molecular weight of 762.06 g/mol. Its IUPAC name is tert-butyl 4-[4-[1-(methanesulfonamido)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate.
| Compound Name | tert-butyl 4-[4-[1-(methanesulfonamido)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate |
|---|---|
| PubChem CID | 171769072 |
| Molecular Formula | C40H55N5O6SSi |
| Molecular Weight | 762.06 g/mol |
| Exact Mass | 761.36 |
| IUPAC Name | tert-butyl 4-[4-[1-(methanesulfonamido)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N2CCN(C3CCCCc4c(NS(C)(=O)=O)cccc43)CC2)cc1Oc1cnc2c(ccn2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C40H55N5O6SSi/c1-40(2,3)51-39(46)34-16-15-30(26-37(34)50-31-25-29-17-18-45(38(29)41-27-31)28-49-23-24-53(5,6)7)43-19-21-44(22-20-43)36-14-9-8-11-32-33(36)12-10-13-35(32)42-52(4,47)48/h10,12-13,15-18,25-27,36,42H,8-9,11,14,19-24,28H2,1-7H3 |
| InChIKey | HQCQLXNFFFWISY-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.06 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|