C42H58N4O5Si — CID 171768988
tert-butyl 4-[4-[1-(1-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate (PubChem CID 171768988) has the molecular formula C42H58N4O5Si and a molecular weight of 727.03 g/mol. Its IUPAC name is tert-butyl 4-[4-[1-(1-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate.
| Compound Name | tert-butyl 4-[4-[1-(1-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate |
|---|---|
| PubChem CID | 171768988 |
| Molecular Formula | C42H58N4O5Si |
| Molecular Weight | 727.03 g/mol |
| Exact Mass | 726.42 |
| IUPAC Name | tert-butyl 4-[4-[1-(1-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]piperazin-1-yl]-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]oxybenzoate |
| SMILES | CC(CO)c1cccc2c1CCCCC2N1CCN(c2ccc(C(=O)OC(C)(C)C)c(Oc3cnc4c(ccn4COCC[Si](C)(C)C)c3)c2)CC1 |
| InChI | InChI=1S/C42H58N4O5Si/c1-30(28-47)34-12-10-13-36-35(34)11-8-9-14-38(36)45-21-19-44(20-22-45)32-15-16-37(41(48)51-42(2,3)4)39(26-32)50-33-25-31-17-18-46(40(31)43-27-33)29-49-23-24-52(5,6)7/h10,12-13,15-18,25-27,30,38,47H,8-9,11,14,19-24,28-29H2,1-7H3 |
| InChIKey | DEJSGPKNLRGVJN-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.03 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|