C16H21N3O5 — CID 155601073
2-hydroxy-6-[1-(2-piperazin-2-ylacetyl)azetidin-3-yl]oxybenzoic acid (PubChem CID 155601073) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-hydroxy-6-[1-(2-piperazin-2-ylacetyl)azetidin-3-yl]oxybenzoic acid.
| Compound Name | 2-hydroxy-6-[1-(2-piperazin-2-ylacetyl)azetidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 155601073 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-hydroxy-6-[1-(2-piperazin-2-ylacetyl)azetidin-3-yl]oxybenzoic acid |
| SMILES | O=C(O)c1c(O)cccc1OC1CN(C(=O)CC2CNCCN2)C1 |
| InChI | InChI=1S/C16H21N3O5/c20-12-2-1-3-13(15(12)16(22)23)24-11-8-19(9-11)14(21)6-10-7-17-4-5-18-10/h1-3,10-11,17-18,20H,4-9H2,(H,22,23) |
| InChIKey | UFOYZEHWJZHCFX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |