C18H23BN2O7 — CID 175080867
2-hydroxy-6-[1-(2-morpholin-2-ylacetyl)azetidin-3-yl]oxy-3-(2-oxoboranylethyl)benzoic acid (PubChem CID 175080867) has the molecular formula C18H23BN2O7 and a molecular weight of 390.20 g/mol. Its IUPAC name is 2-hydroxy-6-[1-(2-morpholin-2-ylacetyl)azetidin-3-yl]oxy-3-(2-oxoboranylethyl)benzoic acid.
| Compound Name | 2-hydroxy-6-[1-(2-morpholin-2-ylacetyl)azetidin-3-yl]oxy-3-(2-oxoboranylethyl)benzoic acid |
|---|---|
| PubChem CID | 175080867 |
| Molecular Formula | C18H23BN2O7 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-hydroxy-6-[1-(2-morpholin-2-ylacetyl)azetidin-3-yl]oxy-3-(2-oxoboranylethyl)benzoic acid |
| SMILES | O=BCCc1ccc(OC2CN(C(=O)CC3CNCCO3)C2)c(C(=O)O)c1O |
| InChI | InChI=1S/C18H23BN2O7/c22-15(7-12-8-20-5-6-27-12)21-9-13(10-21)28-14-2-1-11(3-4-19-26)17(23)16(14)18(24)25/h1-2,12-13,20,23H,3-10H2,(H,24,25) |
| InChIKey | XUWBJOABFPXDGR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|