C19H23BN2O8-2 — CID 167343927
(2S,4R)-5,5-dihydroxy-9-[1-[2-[(2R)-morpholin-2-yl]acetyl]azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylate (PubChem CID 167343927) has the molecular formula C19H23BN2O8-2 and a molecular weight of 418.21 g/mol. Its IUPAC name is (2S,4R)-5,5-dihydroxy-9-[1-[2-[(2R)-morpholin-2-yl]acetyl]azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylate.
| Compound Name | (2S,4R)-5,5-dihydroxy-9-[1-[2-[(2R)-morpholin-2-yl]acetyl]azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylate |
|---|---|
| PubChem CID | 167343927 |
| Molecular Formula | C19H23BN2O8-2 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2S,4R)-5,5-dihydroxy-9-[1-[2-[(2R)-morpholin-2-yl]acetyl]azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylate |
| SMILES | O=C([O-])c1c(OC2CN(C(=O)C[C@@H]3CNCCO3)C2)ccc2c1O[B-](O)(O)[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C19H24BN2O8/c23-16(5-10-7-21-3-4-28-10)22-8-11(9-22)29-15-2-1-12-13-6-14(13)20(26,27)30-18(12)17(15)19(24)25/h1-2,10-11,13-14,21,26-27H,3-9H2,(H,24,25)/q-1/p-1/t10-,13-,14-/m1/s1 |
| InChIKey | QGXBROQKVHXZNL-LERXQTSPSA-M |
| XLogP | -1.81 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|