C21H26BN2O8- — CID 174039187
(2R,5R)-6,6-dihydroxy-10-[1-[2-[(2R)-4-methylmorpholin-2-yl]acetyl]azetidin-3-yl]oxy-7-oxa-6-boranuidatricyclo[6.4.0.02,5]dodeca-1(8),3,9,11-tetraene-9-carboxylic acid (PubChem CID 174039187) has the molecular formula C21H26BN2O8- and a molecular weight of 445.26 g/mol. Its IUPAC name is (2R,5R)-6,6-dihydroxy-10-[1-[2-[(2R)-4-methylmorpholin-2-yl]acetyl]azetidin-3-yl]oxy-7-oxa-6-boranuidatricyclo[6.4.0.02,5]dodeca-1(8),3,9,11-tetraene-9-carboxylic acid.
| Compound Name | (2R,5R)-6,6-dihydroxy-10-[1-[2-[(2R)-4-methylmorpholin-2-yl]acetyl]azetidin-3-yl]oxy-7-oxa-6-boranuidatricyclo[6.4.0.02,5]dodeca-1(8),3,9,11-tetraene-9-carboxylic acid |
|---|---|
| PubChem CID | 174039187 |
| Molecular Formula | C21H26BN2O8- |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (2R,5R)-6,6-dihydroxy-10-[1-[2-[(2R)-4-methylmorpholin-2-yl]acetyl]azetidin-3-yl]oxy-7-oxa-6-boranuidatricyclo[6.4.0.02,5]dodeca-1(8),3,9,11-tetraene-9-carboxylic acid |
| SMILES | CN1CCO[C@H](CC(=O)N2CC(Oc3ccc4c(c3C(=O)O)O[B-](O)(O)[C@@H]3C=C[C@H]43)C2)C1 |
| InChI | InChI=1S/C21H26BN2O8/c1-23-6-7-30-12(9-23)8-18(25)24-10-13(11-24)31-17-5-3-15-14-2-4-16(14)22(28,29)32-20(15)19(17)21(26)27/h2-5,12-14,16,28-29H,6-11H2,1H3,(H,26,27)/q-1/t12-,14-,16-/m1/s1 |
| InChIKey | YGDGCNBGEMSEBA-XNRPHZJLSA-N |
| XLogP | 0.03 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|