C21H29BN2O8 — CID 156730254
6-[(1R,2S)-2-boronocyclopropyl]-2-carboxy-3-[1-[2-[(2S)-4,4-dimethylmorpholin-4-ium-2-yl]acetyl]azetidin-3-yl]oxyphenolate (PubChem CID 156730254) has the molecular formula C21H29BN2O8 and a molecular weight of 448.28 g/mol. Its IUPAC name is 6-[(1R,2S)-2-boronocyclopropyl]-2-carboxy-3-[1-[2-[(2S)-4,4-dimethylmorpholin-4-ium-2-yl]acetyl]azetidin-3-yl]oxyphenolate.
| Compound Name | 6-[(1R,2S)-2-boronocyclopropyl]-2-carboxy-3-[1-[2-[(2S)-4,4-dimethylmorpholin-4-ium-2-yl]acetyl]azetidin-3-yl]oxyphenolate |
|---|---|
| PubChem CID | 156730254 |
| Molecular Formula | C21H29BN2O8 |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 6-[(1R,2S)-2-boronocyclopropyl]-2-carboxy-3-[1-[2-[(2S)-4,4-dimethylmorpholin-4-ium-2-yl]acetyl]azetidin-3-yl]oxyphenolate |
| SMILES | C[N+]1(C)CCO[C@@H](CC(=O)N2CC(Oc3ccc([C@@H]4C[C@@H]4B(O)O)c([O-])c3C(=O)O)C2)C1 |
| InChI | InChI=1S/C21H29BN2O8/c1-24(2)5-6-31-12(11-24)7-18(25)23-9-13(10-23)32-17-4-3-14(15-8-16(15)22(29)30)20(26)19(17)21(27)28/h3-4,12-13,15-16,29-30H,5-11H2,1-2H3,(H-,26,27,28)/t12-,15-,16-/m0/s1 |
| InChIKey | TXGPUVODTDCQKN-RCBQFDQVSA-N |
| XLogP | -0.76 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|