About CID 155601387
CID 155601387 (PubChem CID 155601387) has the molecular formula C8H7FISi
and a molecular weight of 277.13 g/mol.
Molecular Properties
| Compound Name | CID 155601387 |
| PubChem CID | 155601387 |
| Molecular Formula | C8H7FISi |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.93 |
| IUPAC Name | — |
| SMILES | Fc1ccc(CC[Si])c(I)c1 |
| InChI | InChI=1S/C8H7FISi/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5H,3-4H2 |
| InChIKey | MZJDRPDCMOVFCL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 155601387 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155601387?
The IUPAC name of CID 155601387 (CID 155601387) is not available.
What is the SMILES notation for CID 155601387?
The canonical SMILES for CID 155601387 is Fc1ccc(CC[Si])c(I)c1.
What is the InChIKey of CID 155601387?
The InChIKey is MZJDRPDCMOVFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FISi/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5H,3-4H2.
What are the key properties of CID 155601387?
CID 155601387 has a molecular weight of 277.13 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155601387 is sourced from PubChem (CID 155601387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).