C13H12F4INO — CID 24773561
2,2,2-trifluoro-N-[2-(4-fluoro-2-iodophenyl)ethyl]-N-prop-2-enylacetamide (PubChem CID 24773561) has the molecular formula C13H12F4INO and a molecular weight of 401.14 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(4-fluoro-2-iodophenyl)ethyl]-N-prop-2-enylacetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(4-fluoro-2-iodophenyl)ethyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 24773561 |
| Molecular Formula | C13H12F4INO |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(4-fluoro-2-iodophenyl)ethyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(CCc1ccc(F)cc1I)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F4INO/c1-2-6-19(12(20)13(15,16)17)7-5-9-3-4-10(14)8-11(9)18/h2-4,8H,1,5-7H2 |
| InChIKey | UOYJIHYCVKOMJJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|