C35H37N3 — CID 155607504
4-(3,5-dimethylphenyl)-2-[4-[6-(4-methylphenyl)-2-pyridinyl]butyl]-7-propan-2-ylquinazoline (PubChem CID 155607504) has the molecular formula C35H37N3 and a molecular weight of 499.70 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2-[4-[6-(4-methylphenyl)-2-pyridinyl]butyl]-7-propan-2-ylquinazoline.
| Compound Name | 4-(3,5-dimethylphenyl)-2-[4-[6-(4-methylphenyl)-2-pyridinyl]butyl]-7-propan-2-ylquinazoline |
|---|---|
| PubChem CID | 155607504 |
| Molecular Formula | C35H37N3 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2-[4-[6-(4-methylphenyl)-2-pyridinyl]butyl]-7-propan-2-ylquinazoline |
| SMILES | Cc1ccc(-c2cccc(CCCCc3nc(-c4cc(C)cc(C)c4)c4ccc(C(C)C)cc4n3)n2)cc1 |
| InChI | InChI=1S/C35H37N3/c1-23(2)28-17-18-31-33(22-28)37-34(38-35(31)29-20-25(4)19-26(5)21-29)12-7-6-9-30-10-8-11-32(36-30)27-15-13-24(3)14-16-27/h8,10-11,13-23H,6-7,9,12H2,1-5H3 |
| InChIKey | FWHZYHOYOXNCCI-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|