C35H36N2 — CID 155607540
1-(3,5-dimethylphenyl)-4-[4-(6-phenyl-3-pyridinyl)butyl]-6-propan-2-ylisoquinoline (PubChem CID 155607540) has the molecular formula C35H36N2 and a molecular weight of 484.69 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4-[4-(6-phenyl-3-pyridinyl)butyl]-6-propan-2-ylisoquinoline.
| Compound Name | 1-(3,5-dimethylphenyl)-4-[4-(6-phenyl-3-pyridinyl)butyl]-6-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 155607540 |
| Molecular Formula | C35H36N2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4-[4-(6-phenyl-3-pyridinyl)butyl]-6-propan-2-ylisoquinoline |
| SMILES | Cc1cc(C)cc(-c2ncc(CCCCc3ccc(-c4ccccc4)nc3)c3cc(C(C)C)ccc23)c1 |
| InChI | InChI=1S/C35H36N2/c1-24(2)29-15-16-32-33(21-29)30(23-37-35(32)31-19-25(3)18-26(4)20-31)13-9-8-10-27-14-17-34(36-22-27)28-11-6-5-7-12-28/h5-7,11-12,14-24H,8-10,13H2,1-4H3 |
| InChIKey | MFOKFNQHTMKUGA-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|