C19H18IrNO — CID 155610283
iridium(3+);2-methanidyloxypropane;3-phenylisoquinoline (PubChem CID 155610283) has the molecular formula C19H18IrNO and a molecular weight of 468.58 g/mol. Its IUPAC name is iridium(3+);2-methanidyloxypropane;3-phenylisoquinoline.
| Compound Name | iridium(3+);2-methanidyloxypropane;3-phenylisoquinoline |
|---|---|
| PubChem CID | 155610283 |
| Molecular Formula | C19H18IrNO |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | iridium(3+);2-methanidyloxypropane;3-phenylisoquinoline |
| SMILES | [CH2-]OC([CH2-])C.[Ir+3].[c-]1ccccc1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C15H10N.C4H8O.Ir/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-16-15;1-4(2)5-3;/h1-6,8-11H;4H,1,3H2,2H3;/q-1;-2;+3 |
| InChIKey | WDOCHMJDPYKDMJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|