C22H22N2S — CID 155611056
8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-2,5-bis(trideuteriomethyl)-[1]benzothiolo[2,3-b]pyridine (PubChem CID 155611056) has the molecular formula C22H22N2S and a molecular weight of 361.59 g/mol. Its IUPAC name is 8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-2,5-bis(trideuteriomethyl)-[1]benzothiolo[2,3-b]pyridine.
| Compound Name | 8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-2,5-bis(trideuteriomethyl)-[1]benzothiolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 155611056 |
| Molecular Formula | C22H22N2S |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-2,5-bis(trideuteriomethyl)-[1]benzothiolo[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc2c(n1)sc1c(-c3cc(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])ccn3)ccc(C([2H])([2H])[2H])c12 |
| InChI | InChI=1S/C22H22N2S/c1-13-6-8-16(18-12-15(10-11-23-18)22(3,4)5)20-19(13)17-9-7-14(2)24-21(17)25-20/h6-12H,1-5H3/i1D3,2D3,3D3,4D3,5D3 |
| InChIKey | KUFMHUAAXRQRTM-OEBKJCDYSA-N |
| XLogP | 6.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |