C7H16O11S2 — CID 155613493
[3-methyl-2-(sulfooxymethyl)-2-(trioxidanylmethyl)butyl] hydrogen sulfate (PubChem CID 155613493) has the molecular formula C7H16O11S2 and a molecular weight of 340.33 g/mol. Its IUPAC name is [3-methyl-2-(sulfooxymethyl)-2-(trioxidanylmethyl)butyl] hydrogen sulfate.
| Compound Name | [3-methyl-2-(sulfooxymethyl)-2-(trioxidanylmethyl)butyl] hydrogen sulfate |
|---|---|
| PubChem CID | 155613493 |
| Molecular Formula | C7H16O11S2 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | [3-methyl-2-(sulfooxymethyl)-2-(trioxidanylmethyl)butyl] hydrogen sulfate |
| SMILES | CC(C)C(COOO)(COS(=O)(=O)O)COS(=O)(=O)O |
| InChI | InChI=1S/C7H16O11S2/c1-6(2)7(3-15-18-8,4-16-19(9,10)11)5-17-20(12,13)14/h6,8H,3-5H2,1-2H3,(H,9,10,11)(H,12,13,14) |
| InChIKey | LMRAYHGSJPBYEB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|