2-(ethylamino)propyl hydrogen sulfate

C5H13NO4S — CID 123389087

IUPAC2-(ethylamino)propyl hydrogen sulfate
SMILESCCNC(C)COS(=O)(=O)O
InChIInChI=1S/C5H13NO4S/c1-3-6-5(2)4-10-11(7,8)9/h5-6H,3-4H2,1-2H3,(H,7,8,9)
InChIKeyBIAPOPOZFATCCA-UHFFFAOYSA-N
MW183.23 g/mol
LogP-0.20
Rot. Bonds5

About 2-(ethylamino)propyl hydrogen sulfate

2-(ethylamino)propyl hydrogen sulfate (PubChem CID 123389087) has the molecular formula C5H13NO4S and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-(ethylamino)propyl hydrogen sulfate.

Molecular Properties

Compound Name2-(ethylamino)propyl hydrogen sulfate
PubChem CID123389087
Molecular FormulaC5H13NO4S
Molecular Weight183.23 g/mol
Exact Mass183.06
IUPAC Name2-(ethylamino)propyl hydrogen sulfate
SMILESCCNC(C)COS(=O)(=O)O
InChIInChI=1S/C5H13NO4S/c1-3-6-5(2)4-10-11(7,8)9/h5-6H,3-4H2,1-2H3,(H,7,8,9)
InChIKeyBIAPOPOZFATCCA-UHFFFAOYSA-N
XLogP-0.20
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.23
LogP ≤ 5-0.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(ethylamino)propyl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(ethylamino)propyl hydrogen sulfate?
The IUPAC name of 2-(ethylamino)propyl hydrogen sulfate (CID 123389087) is 2-(ethylamino)propyl hydrogen sulfate.
What is the SMILES notation for 2-(ethylamino)propyl hydrogen sulfate?
The canonical SMILES for 2-(ethylamino)propyl hydrogen sulfate is CCNC(C)COS(=O)(=O)O.
What is the InChIKey of 2-(ethylamino)propyl hydrogen sulfate?
The InChIKey is BIAPOPOZFATCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO4S/c1-3-6-5(2)4-10-11(7,8)9/h5-6H,3-4H2,1-2H3,(H,7,8,9).
What are the key properties of 2-(ethylamino)propyl hydrogen sulfate?
2-(ethylamino)propyl hydrogen sulfate has a molecular weight of 183.23 g/mol, XLogP of -0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)propyl hydrogen sulfate is sourced from PubChem (CID 123389087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).