About 2-(ethylamino)propyl propanoate
2-(ethylamino)propyl propanoate (PubChem CID 153018782) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-(ethylamino)propyl propanoate.
Molecular Properties
| Compound Name | 2-(ethylamino)propyl propanoate |
| PubChem CID | 153018782 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-(ethylamino)propyl propanoate |
| SMILES | CCNC(C)COC(=O)CC |
| InChI | InChI=1S/C8H17NO2/c1-4-8(10)11-6-7(3)9-5-2/h7,9H,4-6H2,1-3H3 |
| InChIKey | VBMZAMQYOQDEDO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(ethylamino)propyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)propyl propanoate?
The IUPAC name of 2-(ethylamino)propyl propanoate (CID 153018782) is 2-(ethylamino)propyl propanoate.
What is the SMILES notation for 2-(ethylamino)propyl propanoate?
The canonical SMILES for 2-(ethylamino)propyl propanoate is CCNC(C)COC(=O)CC.
What is the InChIKey of 2-(ethylamino)propyl propanoate?
The InChIKey is VBMZAMQYOQDEDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-4-8(10)11-6-7(3)9-5-2/h7,9H,4-6H2,1-3H3.
What are the key properties of 2-(ethylamino)propyl propanoate?
2-(ethylamino)propyl propanoate has a molecular weight of 159.23 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)propyl propanoate is sourced from PubChem (CID 153018782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).