About 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium)
3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) (PubChem CID 155613734) has the molecular formula C12H9NY31-2
and a molecular weight of 2923.30 g/mol. Its IUPAC name is 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium).
Molecular Properties
| Compound Name | 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) |
| PubChem CID | 155613734 |
| Molecular Formula | C12H9NY31-2 |
| Molecular Weight | 2923.30 g/mol |
| Exact Mass | 2923.16 |
| IUPAC Name | 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) |
| SMILES | Cc1cc[c-]c(-c2[c-]nccc2)c1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C12H9N.31Y/c1-10-4-2-5-11(8-10)12-6-3-7-13-9-12;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/h2-4,6-8H,1H3;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/q-2;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;; |
| InChIKey | IGDYJNSRSVJVQH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 2923.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium)?
The IUPAC name of 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) (CID 155613734) is 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium).
What is the SMILES notation for 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium)?
The canonical SMILES for 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) is Cc1cc[c-]c(-c2[c-]nccc2)c1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium)?
The InChIKey is IGDYJNSRSVJVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.31Y/c1-10-4-2-5-11(8-10)12-6-3-7-13-9-12;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/h2-4,6-8H,1H3;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/q-2;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;.
What are the key properties of 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium)?
3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) has a molecular weight of 2923.30 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylbenzene-6-id-1-yl)-2H-pyridin-2-ide;(yttrium) is sourced from PubChem (CID 155613734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).