C21H27NO — CID 155617808
(4aS,8aR)-6-benzyl-3-isocyano-1,1,4a-trimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-one (PubChem CID 155617808) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (4aS,8aR)-6-benzyl-3-isocyano-1,1,4a-trimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-one.
| Compound Name | (4aS,8aR)-6-benzyl-3-isocyano-1,1,4a-trimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 155617808 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (4aS,8aR)-6-benzyl-3-isocyano-1,1,4a-trimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-one |
| SMILES | [C-]#[N+]C1C[C@]2(C)CC(Cc3ccccc3)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C21H27NO/c1-20(2)18-11-10-16(12-15-8-6-5-7-9-15)13-21(18,3)14-17(22-4)19(20)23/h5-9,16-18H,10-14H2,1-3H3/t16?,17?,18-,21-/m0/s1 |
| InChIKey | ZEDBPBZOEBSWLW-XVAHUTHZSA-N |
| XLogP | 4.94 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|