C23H26FN3O3 — CID 155618906
N-[4-[[2-(4-fluorophenyl)cyclopropyl]amino]butanoyl]-2-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 155618906) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is N-[4-[[2-(4-fluorophenyl)cyclopropyl]amino]butanoyl]-2-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | N-[4-[[2-(4-fluorophenyl)cyclopropyl]amino]butanoyl]-2-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 155618906 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-[4-[[2-(4-fluorophenyl)cyclopropyl]amino]butanoyl]-2-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | O=C(CCCNC1CC1c1ccc(F)cc1)NC(=O)c1ccc2c(c1)CN(O)CC2 |
| InChI | InChI=1S/C23H26FN3O3/c24-19-7-5-16(6-8-19)20-13-21(20)25-10-1-2-22(28)26-23(29)17-4-3-15-9-11-27(30)14-18(15)12-17/h3-8,12,20-21,25,30H,1-2,9-11,13-14H2,(H,26,28,29) |
| InChIKey | HSSDKRQDPHFEHD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|