C22H24FN3O3 — CID 153322706
2-[2-[2-[[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]amino]acetyl]-3,4-dihydro-1H-isoquinolin-7-yl]-N-hydroxyacetamide (PubChem CID 153322706) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-[2-[2-[[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]amino]acetyl]-3,4-dihydro-1H-isoquinolin-7-yl]-N-hydroxyacetamide.
| Compound Name | 2-[2-[2-[[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]amino]acetyl]-3,4-dihydro-1H-isoquinolin-7-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 153322706 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[2-[2-[[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]amino]acetyl]-3,4-dihydro-1H-isoquinolin-7-yl]-N-hydroxyacetamide |
| SMILES | O=C(Cc1ccc2c(c1)CN(C(=O)CN[C@H]1C[C@@H]1c1ccc(F)cc1)CC2)NO |
| InChI | InChI=1S/C22H24FN3O3/c23-18-5-3-16(4-6-18)19-11-20(19)24-12-22(28)26-8-7-15-2-1-14(9-17(15)13-26)10-21(27)25-29/h1-6,9,19-20,24,29H,7-8,10-13H2,(H,25,27)/t19-,20+/m1/s1 |
| InChIKey | CVXKLBYUNVXMFM-UXHICEINSA-N |
| XLogP | 1.90 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|