C20H19NOSi — CID 155619256
trimethyl-(1-phenyl-[1]benzofuro[2,3-c]pyridin-4-yl)silane (PubChem CID 155619256) has the molecular formula C20H19NOSi and a molecular weight of 317.46 g/mol. Its IUPAC name is trimethyl-(1-phenyl-[1]benzofuro[2,3-c]pyridin-4-yl)silane.
| Compound Name | trimethyl-(1-phenyl-[1]benzofuro[2,3-c]pyridin-4-yl)silane |
|---|---|
| PubChem CID | 155619256 |
| Molecular Formula | C20H19NOSi |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | trimethyl-(1-phenyl-[1]benzofuro[2,3-c]pyridin-4-yl)silane |
| SMILES | C[Si](C)(C)c1cnc(-c2ccccc2)c2oc3ccccc3c12 |
| InChI | InChI=1S/C20H19NOSi/c1-23(2,3)17-13-21-19(14-9-5-4-6-10-14)20-18(17)15-11-7-8-12-16(15)22-20/h4-13H,1-3H3 |
| InChIKey | BEIDGJHQHYABFF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|