C35H38F4IrNO2- — CID 155619389
4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-(2,2,2-trifluoroethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethyloct-5-en-4-one;iridium (PubChem CID 155619389) has the molecular formula C35H38F4IrNO2- and a molecular weight of 772.90 g/mol. Its IUPAC name is 4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-(2,2,2-trifluoroethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethyloct-5-en-4-one;iridium.
| Compound Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-(2,2,2-trifluoroethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethyloct-5-en-4-one;iridium |
|---|---|
| PubChem CID | 155619389 |
| Molecular Formula | C35H38F4IrNO2- |
| Molecular Weight | 772.90 g/mol |
| Exact Mass | 773.25 |
| IUPAC Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-(2,2,2-trifluoroethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethyloct-5-en-4-one;iridium |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1[c-]c(-c2nccc3c2ccc2cc(CC(F)(F)F)c(F)cc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C23H16F4N.C12H22O2.Ir/c1-13-7-14(2)9-16(8-13)22-19-4-3-15-10-17(12-23(25,26)27)21(24)11-20(15)18(19)5-6-28-22;1-7-12(5,6)10(14)8-9(13)11(2,3)4;/h3-8,10-11H,12H2,1-2H3;8,13H,7H2,1-6H3;/q-1;;/b;9-8-; |
| InChIKey | YCUXLAGPTBGLME-UVEFWQJBSA-N |
| XLogP | 10.19 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.90 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|