C38H45F3IrNO2- — CID 155619439
4-(3,5-dimethylbenzene-6-id-1-yl)-8-methyl-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-7-hydroxy-4,4,8,8-tetramethylundec-6-en-5-one;iridium (PubChem CID 155619439) has the molecular formula C38H45F3IrNO2- and a molecular weight of 796.99 g/mol. Its IUPAC name is 4-(3,5-dimethylbenzene-6-id-1-yl)-8-methyl-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-7-hydroxy-4,4,8,8-tetramethylundec-6-en-5-one;iridium.
| Compound Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-8-methyl-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-7-hydroxy-4,4,8,8-tetramethylundec-6-en-5-one;iridium |
|---|---|
| PubChem CID | 155619439 |
| Molecular Formula | C38H45F3IrNO2- |
| Molecular Weight | 796.99 g/mol |
| Exact Mass | 797.30 |
| IUPAC Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-8-methyl-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-7-hydroxy-4,4,8,8-tetramethylundec-6-en-5-one;iridium |
| SMILES | CCCC(C)(C)C(=O)/C=C(\O)C(C)(C)CCC.Cc1[c-]c(-c2nccc3c2ccc2cc(C)c(C(F)(F)F)cc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C23H17F3N.C15H28O2.Ir/c1-13-8-14(2)10-17(9-13)22-19-5-4-16-11-15(3)21(23(24,25)26)12-20(16)18(19)6-7-27-22;1-7-9-14(3,4)12(16)11-13(17)15(5,6)10-8-2;/h4-9,11-12H,1-3H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | JMYSCEOKXODEAF-SWPBDETKSA-N |
| XLogP | 11.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.99 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|